Products 78648-43-8

CAS 78648-43-8 is the registry number for (4-Amino-2-methylthiophen-3-yl)methyl hydrogen carbonate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.

Structural formula: {0} (CAS {1})

(4-amino-2-methylthiophen-3-yl)methyl hydrogen carbonate;hydrochloride (CAS 78648-43-8) is a chemical compound with the molecular formula C7H10ClNO3S and a molecular weight of 223.68 g/mol. IUPAC name: (4-amino-2-methylthiophen-3-yl)methyl hydrogen carbonate;hydrochloride. InChIKey: AWJVPBXLCZGMGK-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10ClNO3S
Molecular weight223.68 g/mol
IUPAC name(4-amino-2-methylthiophen-3-yl)methyl hydrogen carbonate;hydrochloride
InChIKeyAWJVPBXLCZGMGK-UHFFFAOYSA-N
SMILESCC1=C(C(=CS1)N)COC(=O)O.Cl

Computed by PubChem (NCBI)