CAS 78648-43-8 is the registry number for (4-Amino-2-methylthiophen-3-yl)methyl hydrogen carbonate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
(4-amino-2-methylthiophen-3-yl)methyl hydrogen carbonate;hydrochloride (CAS 78648-43-8) is a chemical compound with the molecular formula C7H10ClNO3S and a molecular weight of 223.68 g/mol. IUPAC name: (4-amino-2-methylthiophen-3-yl)methyl hydrogen carbonate;hydrochloride. InChIKey: AWJVPBXLCZGMGK-UHFFFAOYSA-N.
| Molecular formula | C7H10ClNO3S |
|---|---|
| Molecular weight | 223.68 g/mol |
| IUPAC name | (4-amino-2-methylthiophen-3-yl)methyl hydrogen carbonate;hydrochloride |
| InChIKey | AWJVPBXLCZGMGK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CS1)N)COC(=O)O.Cl |
Computed by PubChem (NCBI)