CAS 1461714-83-9 appears in our catalog under these names: (4-Cyanooxan-4-yl)methanesulfonyl chloride, 95%, (4-Cyanooxan-4-yl)methanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(4-cyanooxan-4-yl)methanesulfonyl chloride (CAS 1461714-83-9) is a chemical compound with the molecular formula C7H10ClNO3S and a molecular weight of 223.68 g/mol. IUPAC name: (4-cyanooxan-4-yl)methanesulfonyl chloride. InChIKey: XJVUCKURRXVYJL-UHFFFAOYSA-N.
| Molecular formula | C7H10ClNO3S |
|---|---|
| Molecular weight | 223.68 g/mol |
| IUPAC name | (4-cyanooxan-4-yl)methanesulfonyl chloride |
| InChIKey | XJVUCKURRXVYJL-UHFFFAOYSA-N |
| SMILES | C1COCCC1(CS(=O)(=O)Cl)C#N |
Computed by PubChem (NCBI)