CAS 56038-68-7 is the registry number for 5-(Chloromethyl)-N,N-dimethylfuran-2-sulfonamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-(chloromethyl)-N,N-dimethylfuran-2-sulfonamide (CAS 56038-68-7) is a chemical compound with the molecular formula C7H10ClNO3S and a molecular weight of 223.68 g/mol. IUPAC name: 5-(chloromethyl)-N,N-dimethylfuran-2-sulfonamide. InChIKey: IRBKLIJSQPGOFR-UHFFFAOYSA-N.
| Molecular formula | C7H10ClNO3S |
|---|---|
| Molecular weight | 223.68 g/mol |
| IUPAC name | 5-(chloromethyl)-N,N-dimethylfuran-2-sulfonamide |
| InChIKey | IRBKLIJSQPGOFR-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=C(O1)CCl |
Computed by PubChem (NCBI)