Products 2172443-26-2

CAS 2172443-26-2 is the registry number for 2-((2-Methyl-1,3-thiazol-4-yl)methoxy)acetic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-[(2-methyl-1,3-thiazol-4-yl)methoxy]acetic acid;hydrochloride (CAS 2172443-26-2) is a chemical compound with the molecular formula C7H10ClNO3S and a molecular weight of 223.68 g/mol. IUPAC name: 2-[(2-methyl-1,3-thiazol-4-yl)methoxy]acetic acid;hydrochloride. InChIKey: HIKINNXBTJMOHE-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10ClNO3S
Molecular weight223.68 g/mol
IUPAC name2-[(2-methyl-1,3-thiazol-4-yl)methoxy]acetic acid;hydrochloride
InChIKeyHIKINNXBTJMOHE-UHFFFAOYSA-N
SMILESCC1=NC(=CS1)COCC(=O)O.Cl

Computed by PubChem (NCBI)