CAS 14235-78-0 is the registry number for Adrenaline Impurity 39. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(3,4-dihydroxyphenyl)methyl]benzene-1,2-diol (CAS 14235-78-0) is a chemical compound with the molecular formula C13H12O4 and a molecular weight of 232.23 g/mol. IUPAC name: 4-[(3,4-dihydroxyphenyl)methyl]benzene-1,2-diol. InChIKey: GGOBECRWBXYXEY-UHFFFAOYSA-N.
| Molecular formula | C13H12O4 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | 4-[(3,4-dihydroxyphenyl)methyl]benzene-1,2-diol |
| InChIKey | GGOBECRWBXYXEY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC2=CC(=C(C=C2)O)O)O)O |
Computed by PubChem (NCBI)