Products 1423754-84-0
CAS 1423754-84-0 is the registry number for 6-(2,2-Difluoroethoxy)pyridine-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-(2,2-difluoroethoxy)pyridine-2-carboxylic acid (CAS 1423754-84-0) is a chemical compound with the molecular formula C8H7F2NO3 and a molecular weight of 203.14 g/mol. IUPAC name: 6-(2,2-difluoroethoxy)pyridine-2-carboxylic acid. InChIKey: CLGMATKWZACQSQ-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO3 |
|---|---|
| Molecular weight | 203.14 g/mol |
| IUPAC name | 6-(2,2-difluoroethoxy)pyridine-2-carboxylic acid |
| InChIKey | CLGMATKWZACQSQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)OCC(F)F)C(=O)O |
Computed by PubChem (NCBI)