Products 14246-24-3
CAS 14246-24-3 appears in our catalog under these names: DL-3-Phenylalanine-d1, DL-Phenylalanine-2-d1, 98 atom % D, min 98% Chemical Purity, DL–PHENYLALANINE–2–D1, DL-phenylalanine-2-d1. Offered by: MedChemExpress, CDN, GLPBio, Biosynth. Available pack sizes: 1mg, 5mg, 0,5g, 0,25g, 10mg, 100mg, 50mg, 250mg.
2-amino-3-(2-deuteriophenyl)propanoic acid (CAS 14246-24-3) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 166.19 g/mol. IUPAC name: 2-amino-3-(2-deuteriophenyl)propanoic acid. InChIKey: COLNVLDHVKWLRT-QYKNYGDISA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 166.19 g/mol |
| IUPAC name | 2-amino-3-(2-deuteriophenyl)propanoic acid |
| InChIKey | COLNVLDHVKWLRT-QYKNYGDISA-N |
| SMILES | [2H]C1=C(C=CC=C1)CC(C(=O)O)N |
Computed by PubChem (NCBI)