CAS 1425-89-4 appears in our catalog under these names: 1,3-Bis(2-fluorophenyl)propan-2-one, 95%, 1,3-Bis(2-fluorophenyl)propan-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
1,3-bis(2-fluorophenyl)propan-2-one (CAS 1425-89-4) is a chemical compound with the molecular formula C15H12F2O and a molecular weight of 246.25 g/mol. IUPAC name: 1,3-bis(2-fluorophenyl)propan-2-one. InChIKey: ZPMDLKAIBNZIKT-UHFFFAOYSA-N.
| Molecular formula | C15H12F2O |
|---|---|
| Molecular weight | 246.25 g/mol |
| IUPAC name | 1,3-bis(2-fluorophenyl)propan-2-one |
| InChIKey | ZPMDLKAIBNZIKT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)CC2=CC=CC=C2F)F |
Computed by PubChem (NCBI)