CAS 142500-00-3 is the registry number for 1-{6-Methoxy-(1,1'-biphenyl)-3-yl}ethan-1-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-(4-methoxy-3-phenylphenyl)ethanone (CAS 142500-00-3) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: 1-(4-methoxy-3-phenylphenyl)ethanone. InChIKey: CDAYYHVTEXXQJQ-UHFFFAOYSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 1-(4-methoxy-3-phenylphenyl)ethanone |
| InChIKey | CDAYYHVTEXXQJQ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)OC)C2=CC=CC=C2 |
Computed by PubChem (NCBI)