CAS 1425366-64-8 is the registry number for 3-(4-Chlorophenyl)-4-piperidinone Hydrochloride. Offered by: TRC. Available pack sizes: 2,5g.
3-(4-chlorophenyl)piperidin-4-one;hydrochloride (CAS 1425366-64-8) is a chemical compound with the molecular formula C11H13Cl2NO and a molecular weight of 246.13 g/mol. IUPAC name: 3-(4-chlorophenyl)piperidin-4-one;hydrochloride. InChIKey: MAXYZBQVIJBVKR-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2NO |
|---|---|
| Molecular weight | 246.13 g/mol |
| IUPAC name | 3-(4-chlorophenyl)piperidin-4-one;hydrochloride |
| InChIKey | MAXYZBQVIJBVKR-UHFFFAOYSA-N |
| SMILES | C1CNCC(C1=O)C2=CC=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)