CAS 142577-01-3 appears in our catalog under these names: 4-Isopropyl-6-methoxysaccharin, 95%, 4-Isopropyl-6-methoxybenzo(d)isothiazol-3(2H)-one 1,1-dioxide, 97%, 4–Isopropyl–6–Methoxysaccharin. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
6-methoxy-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one (CAS 142577-01-3) is a chemical compound with the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. IUPAC name: 6-methoxy-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one. InChIKey: SGQJHTPAGPKONZ-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4S |
|---|---|
| Molecular weight | 255.29 g/mol |
| IUPAC name | 6-methoxy-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one |
| InChIKey | SGQJHTPAGPKONZ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C2C(=CC(=C1)OC)S(=O)(=O)NC2=O |
Computed by PubChem (NCBI)