CAS 1425973-17-6 appears in our catalog under these names: (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)but-3-enoic acid, 95%, 95%, Fmoc-D-Gly(Vinyl)-OH, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)but-3-enoic acid (CAS 1425973-17-6) is a chemical compound with the molecular formula C19H17NO4 and a molecular weight of 323.3 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)but-3-enoic acid. InChIKey: WKYFUFWCJIKRCS-QGZVFWFLSA-N.
| Molecular formula | C19H17NO4 |
|---|---|
| Molecular weight | 323.3 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)but-3-enoic acid |
| InChIKey | WKYFUFWCJIKRCS-QGZVFWFLSA-N |
| SMILES | C=C[C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)