CAS 14261-91-7 is the registry number for 1-Oxo-2-(p-tolyl)-1,2,3,6,7,7a-hexahydro-3a,6-epoxyisoindole-7-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
3-(4-methylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylic acid (CAS 14261-91-7) is a chemical compound with the molecular formula C16H15NO4 and a molecular weight of 285.29 g/mol. IUPAC name: 3-(4-methylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylic acid. InChIKey: KUFKGDZHWPMXNX-UHFFFAOYSA-N.
| Molecular formula | C16H15NO4 |
|---|---|
| Molecular weight | 285.29 g/mol |
| IUPAC name | 3-(4-methylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylic acid |
| InChIKey | KUFKGDZHWPMXNX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2CC34C=CC(O3)C(C4C2=O)C(=O)O |
Computed by PubChem (NCBI)