CAS 142641-33-6 is the registry number for Methyl 3-amino-1h-indole-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
Methyl 3-amino-1H-indole-2-carboxylate (CAS 142641-33-6) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: methyl 3-amino-1H-indole-2-carboxylate. InChIKey: ZHQZMSFQHYXWBW-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | methyl 3-amino-1H-indole-2-carboxylate |
| InChIKey | ZHQZMSFQHYXWBW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=CC=CC=C2N1)N |
Computed by PubChem (NCBI)