Products 1426437-45-7

CAS 1426437-45-7 appears in our catalog under these names: 5–(Chlorosulfonyl)–2–methylbenzoyl chloride, 5-(Chlorosulfonyl)-2-methylbenzoyl chloride. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 0,5g, 5g.

Structural formula: {0} (CAS {1})

5-chlorosulfonyl-2-methylbenzoyl chloride (CAS 1426437-45-7) is a chemical compound with the molecular formula C8H6Cl2O3S and a molecular weight of 253.10 g/mol. IUPAC name: 5-chlorosulfonyl-2-methylbenzoyl chloride. InChIKey: LIANSSSABWUTRH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6Cl2O3S
Molecular weight253.10 g/mol
IUPAC name5-chlorosulfonyl-2-methylbenzoyl chloride
InChIKeyLIANSSSABWUTRH-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)S(=O)(=O)Cl)C(=O)Cl

Computed by PubChem (NCBI)