Products 32766-64-6

CAS 32766-64-6 is the registry number for Ethyl 2-(2,5-dichlorothiophen-3-yl)-2-oxoacetate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 2-(2,5-dichlorothiophen-3-yl)-2-oxoacetate (CAS 32766-64-6) is a chemical compound with the molecular formula C8H6Cl2O3S and a molecular weight of 253.10 g/mol. IUPAC name: ethyl 2-(2,5-dichlorothiophen-3-yl)-2-oxoacetate. InChIKey: IZEPVHXRDFHYNR-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6Cl2O3S
Molecular weight253.10 g/mol
IUPAC nameethyl 2-(2,5-dichlorothiophen-3-yl)-2-oxoacetate
InChIKeyIZEPVHXRDFHYNR-UHFFFAOYSA-N
SMILESCCOC(=O)C(=O)C1=C(SC(=C1)Cl)Cl

Computed by PubChem (NCBI)