CAS 32766-64-6 is the registry number for Ethyl 2-(2,5-dichlorothiophen-3-yl)-2-oxoacetate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
Ethyl 2-(2,5-dichlorothiophen-3-yl)-2-oxoacetate (CAS 32766-64-6) is a chemical compound with the molecular formula C8H6Cl2O3S and a molecular weight of 253.10 g/mol. IUPAC name: ethyl 2-(2,5-dichlorothiophen-3-yl)-2-oxoacetate. InChIKey: IZEPVHXRDFHYNR-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O3S |
|---|---|
| Molecular weight | 253.10 g/mol |
| IUPAC name | ethyl 2-(2,5-dichlorothiophen-3-yl)-2-oxoacetate |
| InChIKey | IZEPVHXRDFHYNR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1=C(SC(=C1)Cl)Cl |
Computed by PubChem (NCBI)