CAS 1461708-46-2 is the registry number for 5-Chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride (CAS 1461708-46-2) is a chemical compound with the molecular formula C8H6Cl2O3S and a molecular weight of 253.10 g/mol. IUPAC name: 5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride. InChIKey: QOCMCTGCKAMOPC-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O3S |
|---|---|
| Molecular weight | 253.10 g/mol |
| IUPAC name | 5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride |
| InChIKey | QOCMCTGCKAMOPC-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)