Products 547739-67-3
CAS 547739-67-3 appears in our catalog under these names: 3–(Chlorosulfonyl)–4–methylbenzoyl chloride, 3-(Chlorosulfonyl)-4-methylbenzoyl chloride 95%, 3-(CHLOROSULFONYL)-4-METHYLBENZOYL CHLORIDE, 95%, 3-(Chlorosulfonyl)-4-methylbenzoyl chloride, 95%, 95%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-chlorosulfonyl-4-methylbenzoyl chloride (CAS 547739-67-3) is a chemical compound with the molecular formula C8H6Cl2O3S and a molecular weight of 253.10 g/mol. IUPAC name: 3-chlorosulfonyl-4-methylbenzoyl chloride. InChIKey: BSHLCKNAKRLVSS-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O3S |
|---|---|
| Molecular weight | 253.10 g/mol |
| IUPAC name | 3-chlorosulfonyl-4-methylbenzoyl chloride |
| InChIKey | BSHLCKNAKRLVSS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)