CAS 3511-47-5 appears in our catalog under these names: 5–Acetyl–2–chlorobenzene–1–sulfonyl chloride, 5-Acetyl-2-chlorobenzene-1-sulfonyl chloride, 5-Acetyl-2-chlorobenzene-1-sulfonyl chloride, 95%. Offered by: GLPBio, Biosynth, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg, 50mg, 0,5g.
5-acetyl-2-chlorobenzenesulfonyl chloride (CAS 3511-47-5) is a chemical compound with the molecular formula C8H6Cl2O3S and a molecular weight of 253.10 g/mol. IUPAC name: 5-acetyl-2-chlorobenzenesulfonyl chloride. InChIKey: XWIWYJKLMNGMLH-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O3S |
|---|---|
| Molecular weight | 253.10 g/mol |
| IUPAC name | 5-acetyl-2-chlorobenzenesulfonyl chloride |
| InChIKey | XWIWYJKLMNGMLH-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)