Products 1427081-30-8

CAS 1427081-30-8 is the registry number for 4-(Methoxycarbonyl)thiazole-5-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-methoxycarbonyl-1,3-thiazole-5-carboxylic acid (CAS 1427081-30-8) is a chemical compound with the molecular formula C6H5NO4S and a molecular weight of 187.18 g/mol. IUPAC name: 4-methoxycarbonyl-1,3-thiazole-5-carboxylic acid. InChIKey: PARUOHBIOSUCMG-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5NO4S
Molecular weight187.18 g/mol
IUPAC name4-methoxycarbonyl-1,3-thiazole-5-carboxylic acid
InChIKeyPARUOHBIOSUCMG-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(SC=N1)C(=O)O

Computed by PubChem (NCBI)