Products 1891274-16-0

CAS 1891274-16-0 is the registry number for 5-(Methoxycarbonyl)-1,2-thiazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

5-methoxycarbonyl-1,2-thiazole-3-carboxylic acid (CAS 1891274-16-0) is a chemical compound with the molecular formula C6H5NO4S and a molecular weight of 187.18 g/mol. IUPAC name: 5-methoxycarbonyl-1,2-thiazole-3-carboxylic acid. InChIKey: UHLLTSXSWXNRNY-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5NO4S
Molecular weight187.18 g/mol
IUPAC name5-methoxycarbonyl-1,2-thiazole-3-carboxylic acid
InChIKeyUHLLTSXSWXNRNY-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=NS1)C(=O)O

Computed by PubChem (NCBI)