CAS 36050-35-8 appears in our catalog under these names: 5-Methyl-4-nitrothiophene-2-carboxylic acid, 95%, 2-Methyl-3-nitrothiophene-5-carboxylic Acid, 97%, 2–Methyl–3–nitrothiophene–5–carboxylic Acid, 5-methyl-4-nitrothiophene-2-carboxylic acid, 2-Methyl-3-nitrothiophene-5-carboxylic Acid 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 5g, 1g, 25g, 10g, 250mg.
5-methyl-4-nitrothiophene-2-carboxylic acid (CAS 36050-35-8) is a chemical compound with the molecular formula C6H5NO4S and a molecular weight of 187.18 g/mol. IUPAC name: 5-methyl-4-nitrothiophene-2-carboxylic acid. InChIKey: HUDBBNDAVUUGEF-UHFFFAOYSA-N.
| Molecular formula | C6H5NO4S |
|---|---|
| Molecular weight | 187.18 g/mol |
| IUPAC name | 5-methyl-4-nitrothiophene-2-carboxylic acid |
| InChIKey | HUDBBNDAVUUGEF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(S1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)