Products 36034-99-8
CAS 36034-99-8 appears in our catalog under these names: 4-Methyl-5-nitrothiophene-2-carboxylic acid 95%, 4-Methyl-5-nitro-2-thiophenecarboxylic acid, 98%, 98%, 4-Methyl-5-nitro-2-thiophenecarboxylic acid, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-methyl-5-nitrothiophene-2-carboxylic acid (CAS 36034-99-8) is a chemical compound with the molecular formula C6H5NO4S and a molecular weight of 187.18 g/mol. IUPAC name: 4-methyl-5-nitrothiophene-2-carboxylic acid. InChIKey: XITPPHSEASXSHB-UHFFFAOYSA-N.
| Molecular formula | C6H5NO4S |
|---|---|
| Molecular weight | 187.18 g/mol |
| IUPAC name | 4-methyl-5-nitrothiophene-2-carboxylic acid |
| InChIKey | XITPPHSEASXSHB-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=C1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)