Products 67048-61-7

CAS 67048-61-7 is the registry number for 3-Methylisothiazole-4,5-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-methyl-1,2-thiazole-4,5-dicarboxylic acid (CAS 67048-61-7) is a chemical compound with the molecular formula C6H5NO4S and a molecular weight of 187.18 g/mol. IUPAC name: 3-methyl-1,2-thiazole-4,5-dicarboxylic acid. InChIKey: XBBBUMLSXVQCFE-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5NO4S
Molecular weight187.18 g/mol
IUPAC name3-methyl-1,2-thiazole-4,5-dicarboxylic acid
InChIKeyXBBBUMLSXVQCFE-UHFFFAOYSA-N
SMILESCC1=NSC(=C1C(=O)O)C(=O)O

Computed by PubChem (NCBI)