Products 1427177-15-8
CAS 1427177-15-8 is the registry number for Dechloro Dehydro Griseofulvin. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-3',4,6-trimethoxy-5'-methylspiro[1-benzofuran-2,4'-cyclohexa-2,5-diene]-1',3-dione (CAS 1427177-15-8) is a chemical compound with the molecular formula C17H16O6 and a molecular weight of 316.30 g/mol. IUPAC name: (2S)-3',4,6-trimethoxy-5'-methylspiro[1-benzofuran-2,4'-cyclohexa-2,5-diene]-1',3-dione. InChIKey: CHQXBZFVCIIBRO-KRWDZBQOSA-N.
| Molecular formula | C17H16O6 |
|---|---|
| Molecular weight | 316.30 g/mol |
| IUPAC name | (2S)-3',4,6-trimethoxy-5'-methylspiro[1-benzofuran-2,4'-cyclohexa-2,5-diene]-1',3-dione |
| InChIKey | CHQXBZFVCIIBRO-KRWDZBQOSA-N |
| SMILES | CC1=CC(=O)C=C([C@]12C(=O)C3=C(O2)C=C(C=C3OC)OC)OC |
Computed by PubChem (NCBI)