CAS 379725-36-7 is the registry number for 4-Formyl-2-methoxyphenyl 3,4-dimethoxybenzoate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(4-formyl-2-methoxyphenyl) 3,4-dimethoxybenzoate (CAS 379725-36-7) is a chemical compound with the molecular formula C17H16O6 and a molecular weight of 316.30 g/mol. IUPAC name: (4-formyl-2-methoxyphenyl) 3,4-dimethoxybenzoate. InChIKey: FPQDKMABOMLQGJ-UHFFFAOYSA-N.
| Molecular formula | C17H16O6 |
|---|---|
| Molecular weight | 316.30 g/mol |
| IUPAC name | (4-formyl-2-methoxyphenyl) 3,4-dimethoxybenzoate |
| InChIKey | FPQDKMABOMLQGJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)OC2=C(C=C(C=C2)C=O)OC)OC |
Computed by PubChem (NCBI)