Products 58286-56-9
CAS 58286-56-9 appears in our catalog under these names: Nanaomycin alphaA, OM173-αA, OM173–αA, OM173-alphaA, Nanaomycin αA. Offered by: TRC, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 50mg, 1mg, 5mg, 500ug, 500μg, 500 μg.
Methyl 2-[(1S,3R)-9-hydroxy-1-methyl-5,10-dioxo-3,4-dihydro-1H-benzo[g]isochromen-3-yl]acetate (CAS 58286-56-9) is a chemical compound with the molecular formula C17H16O6 and a molecular weight of 316.30 g/mol. IUPAC name: methyl 2-[(1S,3R)-9-hydroxy-1-methyl-5,10-dioxo-3,4-dihydro-1H-benzo[g]isochromen-3-yl]acetate. InChIKey: FMEUWIKCSICJBO-DTWKUNHWSA-N.
| Molecular formula | C17H16O6 |
|---|---|
| Molecular weight | 316.30 g/mol |
| IUPAC name | methyl 2-[(1S,3R)-9-hydroxy-1-methyl-5,10-dioxo-3,4-dihydro-1H-benzo[g]isochromen-3-yl]acetate |
| InChIKey | FMEUWIKCSICJBO-DTWKUNHWSA-N |
| SMILES | C[C@H]1C2=C(C[C@@H](O1)CC(=O)OC)C(=O)C3=C(C2=O)C(=CC=C3)O |
Computed by PubChem (NCBI)