CAS 78641-40-4 appears in our catalog under these names: ((4–methoxyphenyl)methyl) hydrogen (4–hydroxyphenyl)malonate, 1-[(4-Methoxyphenyl)methyl] 2-(4-hydroxyphenyl)propanedioate, 95%, 95%, 2-(4-Hydroxyphenyl)-3-((4-methoxybenzyl)oxy)-3-oxopropanoic acid, 95%, 2-(4-Hydroxyphenyl)-3-((4-methoxybenzyl)oxy)-3-oxopropanoic acid, 96%. Offered by: GLPBio, Chemat, Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
2-(4-hydroxyphenyl)-3-[(4-methoxyphenyl)methoxy]-3-oxopropanoic acid (CAS 78641-40-4) is a chemical compound with the molecular formula C17H16O6 and a molecular weight of 316.30 g/mol. IUPAC name: 2-(4-hydroxyphenyl)-3-[(4-methoxyphenyl)methoxy]-3-oxopropanoic acid. InChIKey: JHALLYTYXLWETG-UHFFFAOYSA-N.
| Molecular formula | C17H16O6 |
|---|---|
| Molecular weight | 316.30 g/mol |
| IUPAC name | 2-(4-hydroxyphenyl)-3-[(4-methoxyphenyl)methoxy]-3-oxopropanoic acid |
| InChIKey | JHALLYTYXLWETG-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)COC(=O)C(C2=CC=C(C=C2)O)C(=O)O |
Computed by PubChem (NCBI)