Products 146776-39-8
CAS 146776-39-8 is the registry number for Urolithin D Tetramethyl Ether, >95% (HPLC). Offered by: TRC. Available pack sizes: 25mg, 5mg.
3,4,8,9-tetramethoxybenzo[c]chromen-6-one (CAS 146776-39-8) is a chemical compound with the molecular formula C17H16O6 and a molecular weight of 316.30 g/mol. IUPAC name: 3,4,8,9-tetramethoxybenzo[c]chromen-6-one. InChIKey: OGOVURNLUWRGET-UHFFFAOYSA-N.
| Molecular formula | C17H16O6 |
|---|---|
| Molecular weight | 316.30 g/mol |
| IUPAC name | 3,4,8,9-tetramethoxybenzo[c]chromen-6-one |
| InChIKey | OGOVURNLUWRGET-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)C3=CC(=C(C=C3C(=O)O2)OC)OC)OC |
Computed by PubChem (NCBI)