CAS 1427413-83-9 appears in our catalog under these names: 4-Amino-2-chloro-5-fluoro-benzoic acid methyl ester, 95%, 4-Amino-2-chloro-5-fluoro-benzoic acid methyl ester, 95%, 95%, Methyl 4-amino-2-chloro-5-fluorobenzoate, 98%, Methyl 4-amino-2-chloro-5-fluorobenzoate, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 100mg.
Methyl 4-amino-2-chloro-5-fluorobenzoate (CAS 1427413-83-9) is a chemical compound with the molecular formula C8H7ClFNO2 and a molecular weight of 203.60 g/mol. IUPAC name: methyl 4-amino-2-chloro-5-fluorobenzoate. InChIKey: ZMJAVSHQQUKUPV-UHFFFAOYSA-N.
| Molecular formula | C8H7ClFNO2 |
|---|---|
| Molecular weight | 203.60 g/mol |
| IUPAC name | methyl 4-amino-2-chloro-5-fluorobenzoate |
| InChIKey | ZMJAVSHQQUKUPV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1Cl)N)F |
Computed by PubChem (NCBI)