Products 1427427-96-0
CAS 1427427-96-0 appears in our catalog under these names: 3-Fluoro-2-methoxy-5-methylbenzoic acid, 95%, 3-Fluoro-2-methoxy-5-methylbenzoic acid 98%, 3-Fluoro-2-methoxy-5-methylbenzoic acid, ≥95%, ≥95%, 3-Fluoro-2-methoxy-5-methylbenzoic acid. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 250mg, 1g, 100mg.
3-fluoro-2-methoxy-5-methylbenzoic acid (CAS 1427427-96-0) is a chemical compound with the molecular formula C9H9FO3 and a molecular weight of 184.16 g/mol. IUPAC name: 3-fluoro-2-methoxy-5-methylbenzoic acid. InChIKey: XQLNAFMTEWKAEJ-UHFFFAOYSA-N.
| Molecular formula | C9H9FO3 |
|---|---|
| Molecular weight | 184.16 g/mol |
| IUPAC name | 3-fluoro-2-methoxy-5-methylbenzoic acid |
| InChIKey | XQLNAFMTEWKAEJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)F)OC)C(=O)O |
Computed by PubChem (NCBI)