Products 1427433-05-3
CAS 1427433-05-3 appears in our catalog under these names: 2-Fluoro-6-methoxy-3-methylbenzoic acid, 2-Fluoro-6-methoxy-3-methylbenzoic acid, 95%, 2-Fluoro-6-methoxy-3-methylbenzoic acid, 98%. Offered by: Fluorochem, Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.
2-fluoro-6-methoxy-3-methylbenzoic acid (CAS 1427433-05-3) is a chemical compound with the molecular formula C9H9FO3 and a molecular weight of 184.16 g/mol. IUPAC name: 2-fluoro-6-methoxy-3-methylbenzoic acid. InChIKey: RVXOWRPVJWQUDE-UHFFFAOYSA-N.
| Molecular formula | C9H9FO3 |
|---|---|
| Molecular weight | 184.16 g/mol |
| IUPAC name | 2-fluoro-6-methoxy-3-methylbenzoic acid |
| InChIKey | RVXOWRPVJWQUDE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)OC)C(=O)O)F |
Computed by PubChem (NCBI)