Products 1427433-12-2
CAS 1427433-12-2 appears in our catalog under these names: 6-Fluoro-2-methoxy-3-methylbenzoic acid, 6-Fluoro-2-methoxy-3-methylbenzoic acid, 95%. Offered by: Fluorochem, Combi-blocks. Available pack sizes: 1g, 5g, 25g, 10g, 250mg.
6-fluoro-2-methoxy-3-methylbenzoic acid (CAS 1427433-12-2) is a chemical compound with the molecular formula C9H9FO3 and a molecular weight of 184.16 g/mol. IUPAC name: 6-fluoro-2-methoxy-3-methylbenzoic acid. InChIKey: OQQBMUBHZRGQAW-UHFFFAOYSA-N.
| Molecular formula | C9H9FO3 |
|---|---|
| Molecular weight | 184.16 g/mol |
| IUPAC name | 6-fluoro-2-methoxy-3-methylbenzoic acid |
| InChIKey | OQQBMUBHZRGQAW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)F)C(=O)O)OC |
Computed by PubChem (NCBI)