Products 1427501-68-5
CAS 1427501-68-5 is the registry number for Ethyl 2-amino-5-chloro-2,3-dihydro-1H-indene-2-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Ethyl 2-amino-5-chloro-1,3-dihydroindene-2-carboxylate;hydrochloride (CAS 1427501-68-5) is a chemical compound with the molecular formula C12H15Cl2NO2 and a molecular weight of 276.16 g/mol. IUPAC name: ethyl 2-amino-5-chloro-1,3-dihydroindene-2-carboxylate;hydrochloride. InChIKey: YBJRHRWEEUSVBD-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2NO2 |
|---|---|
| Molecular weight | 276.16 g/mol |
| IUPAC name | ethyl 2-amino-5-chloro-1,3-dihydroindene-2-carboxylate;hydrochloride |
| InChIKey | YBJRHRWEEUSVBD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CC2=C(C1)C=C(C=C2)Cl)N.Cl |
Computed by PubChem (NCBI)