Products 1428139-34-7
CAS 1428139-34-7 appears in our catalog under these names: 6-(2,3,4-Trimethoxyphenyl)-1,5,6,7-tetrahydro-4h-indazol-4-one, 95%, 6-(2,3,4-Trimethoxyphenyl)-1,5,6,7-tetrahydro-4H-indazol-4-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 2000mg, 1000mg, 5000mg, 10000mg.
6-(2,3,4-trimethoxyphenyl)-1,5,6,7-tetrahydroindazol-4-one (CAS 1428139-34-7) is a chemical compound with the molecular formula C16H18N2O4 and a molecular weight of 302.32 g/mol. IUPAC name: 6-(2,3,4-trimethoxyphenyl)-1,5,6,7-tetrahydroindazol-4-one. InChIKey: MOLBRHLCCHMUKD-UHFFFAOYSA-N.
| Molecular formula | C16H18N2O4 |
|---|---|
| Molecular weight | 302.32 g/mol |
| IUPAC name | 6-(2,3,4-trimethoxyphenyl)-1,5,6,7-tetrahydroindazol-4-one |
| InChIKey | MOLBRHLCCHMUKD-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C2CC3=C(C=NN3)C(=O)C2)OC)OC |
Computed by PubChem (NCBI)