CAS 1428139-42-7 is the registry number for Ethyl 3-amino-6-(5-methyl-2-furyl)-4-oxo-4,5,6,7-tetrahydro-1h-indole-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl 3-amino-6-(5-methylfuran-2-yl)-4-oxo-1,5,6,7-tetrahydroindole-2-carboxylate (CAS 1428139-42-7) is a chemical compound with the molecular formula C16H18N2O4 and a molecular weight of 302.32 g/mol. IUPAC name: ethyl 3-amino-6-(5-methylfuran-2-yl)-4-oxo-1,5,6,7-tetrahydroindole-2-carboxylate. InChIKey: QIKPSKZWYCGLSL-UHFFFAOYSA-N.
| Molecular formula | C16H18N2O4 |
|---|---|
| Molecular weight | 302.32 g/mol |
| IUPAC name | ethyl 3-amino-6-(5-methylfuran-2-yl)-4-oxo-1,5,6,7-tetrahydroindole-2-carboxylate |
| InChIKey | QIKPSKZWYCGLSL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(N1)CC(CC2=O)C3=CC=C(O3)C)N |
Computed by PubChem (NCBI)