CAS 74938-90-2 appears in our catalog under these names: H-Glu-4mbna, 95%, (S)-4-Amino-5-((4-methoxynaphthalen-2-yl)amino)-5-oxopentanoic acid, 95+%, H–Glu–4MβNA. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 100mg, 1g, 50mg.
(4S)-4-amino-5-[(4-methoxynaphthalen-2-yl)amino]-5-oxopentanoic acid (CAS 74938-90-2) is a chemical compound with the molecular formula C16H18N2O4 and a molecular weight of 302.32 g/mol. IUPAC name: (4S)-4-amino-5-[(4-methoxynaphthalen-2-yl)amino]-5-oxopentanoic acid. InChIKey: JKMBFBPDQHOZTG-ZDUSSCGKSA-N.
| Molecular formula | C16H18N2O4 |
|---|---|
| Molecular weight | 302.32 g/mol |
| IUPAC name | (4S)-4-amino-5-[(4-methoxynaphthalen-2-yl)amino]-5-oxopentanoic acid |
| InChIKey | JKMBFBPDQHOZTG-ZDUSSCGKSA-N |
| SMILES | COC1=CC(=CC2=CC=CC=C21)NC(=O)[C@H](CCC(=O)O)N |
Computed by PubChem (NCBI)