Products 1707392-22-0

CAS 1707392-22-0 is the registry number for 4-Butoxy-1-(4-methylphenyl)-6-oxo-1,6-dihydropyridazine-3-carboxylic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

4-butoxy-1-(4-methylphenyl)-6-oxopyridazine-3-carboxylic acid (CAS 1707392-22-0) is a chemical compound with the molecular formula C16H18N2O4 and a molecular weight of 302.32 g/mol. IUPAC name: 4-butoxy-1-(4-methylphenyl)-6-oxopyridazine-3-carboxylic acid. InChIKey: DPFDUEONOXZXSV-UHFFFAOYSA-N.

Identity
Molecular formulaC16H18N2O4
Molecular weight302.32 g/mol
IUPAC name4-butoxy-1-(4-methylphenyl)-6-oxopyridazine-3-carboxylic acid
InChIKeyDPFDUEONOXZXSV-UHFFFAOYSA-N
SMILESCCCCOC1=CC(=O)N(N=C1C(=O)O)C2=CC=C(C=C2)C

Computed by PubChem (NCBI)