Products 303150-38-1
CAS 303150-38-1 is the registry number for Methyl 1-[4-(tert-butyl)phenyl]-4-hydroxy-6-oxo-1,6-dihydro-3-pyridazinecarboxylate, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 1-(4-tert-butylphenyl)-4-hydroxy-6-oxopyridazine-3-carboxylate (CAS 303150-38-1) is a chemical compound with the molecular formula C16H18N2O4 and a molecular weight of 302.32 g/mol. IUPAC name: methyl 1-(4-tert-butylphenyl)-4-hydroxy-6-oxopyridazine-3-carboxylate. InChIKey: JSRGIZKBWYGPNW-UHFFFAOYSA-N.
| Molecular formula | C16H18N2O4 |
|---|---|
| Molecular weight | 302.32 g/mol |
| IUPAC name | methyl 1-(4-tert-butylphenyl)-4-hydroxy-6-oxopyridazine-3-carboxylate |
| InChIKey | JSRGIZKBWYGPNW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)N2C(=O)C=C(C(=N2)C(=O)OC)O |
Computed by PubChem (NCBI)