Products 1429129-71-4
CAS 1429129-71-4 is the registry number for OXFBD03. Offered by: MedChemExpress. Available pack sizes: Get quote.
[3-(3,5-dimethyl-1,2-oxazol-4-yl)-5-[hydroxy(phenyl)methyl]phenyl] acetate (CAS 1429129-71-4) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: [3-(3,5-dimethyl-1,2-oxazol-4-yl)-5-[hydroxy(phenyl)methyl]phenyl] acetate. InChIKey: BLNKHZBHJDYSGF-UHFFFAOYSA-N.
| Molecular formula | C20H19NO4 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | [3-(3,5-dimethyl-1,2-oxazol-4-yl)-5-[hydroxy(phenyl)methyl]phenyl] acetate |
| InChIKey | BLNKHZBHJDYSGF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)C2=CC(=CC(=C2)OC(=O)C)C(C3=CC=CC=C3)O |
Computed by PubChem (NCBI)