CAS 142955-50-8 is the registry number for N-Boc-glycine N-Carboxyanhydride. Offered by: TRC, Biosynth. Available pack sizes: 10g, 0,5g, 1g, 2g, 5g.
Tert-butyl 2,5-dioxo-1,3-oxazolidine-3-carboxylate (CAS 142955-50-8) is a chemical compound with the molecular formula C8H11NO5 and a molecular weight of 201.18 g/mol. IUPAC name: tert-butyl 2,5-dioxo-1,3-oxazolidine-3-carboxylate. InChIKey: MTEOSPVWMLTGFN-UHFFFAOYSA-N.
| Molecular formula | C8H11NO5 |
|---|---|
| Molecular weight | 201.18 g/mol |
| IUPAC name | tert-butyl 2,5-dioxo-1,3-oxazolidine-3-carboxylate |
| InChIKey | MTEOSPVWMLTGFN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)OC1=O |
Computed by PubChem (NCBI)