Products 82386-73-0
CAS 82386-73-0 is the registry number for 2-(2-Carboxyethyl)-5-oxopyrrolidine-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-carboxyethyl)-5-oxopyrrolidine-2-carboxylic acid (CAS 82386-73-0) is a chemical compound with the molecular formula C8H11NO5 and a molecular weight of 201.18 g/mol. IUPAC name: 2-(2-carboxyethyl)-5-oxopyrrolidine-2-carboxylic acid. InChIKey: JUZXLUDCIRRWRT-UHFFFAOYSA-N.
| Molecular formula | C8H11NO5 |
|---|---|
| Molecular weight | 201.18 g/mol |
| IUPAC name | 2-(2-carboxyethyl)-5-oxopyrrolidine-2-carboxylic acid |
| InChIKey | JUZXLUDCIRRWRT-UHFFFAOYSA-N |
| SMILES | C1CC(NC1=O)(CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)