CAS 19363-27-0 is the registry number for γ-Ethyl L-glutamate N-carboxyanhydride. Offered by: Biosynth. Available pack sizes: 5g, 1g, 10g, 25g.
Ethyl 3-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]propanoate (CAS 19363-27-0) is a chemical compound with the molecular formula C8H11NO5 and a molecular weight of 201.18 g/mol. IUPAC name: ethyl 3-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]propanoate. InChIKey: FHBKACWGGGMHSG-YFKPBYRVSA-N.
| Molecular formula | C8H11NO5 |
|---|---|
| Molecular weight | 201.18 g/mol |
| IUPAC name | ethyl 3-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]propanoate |
| InChIKey | FHBKACWGGGMHSG-YFKPBYRVSA-N |
| SMILES | CCOC(=O)CC[C@H]1C(=O)OC(=O)N1 |
Computed by PubChem (NCBI)