Products 19363-27-0

CAS 19363-27-0 is the registry number for γ-Ethyl L-glutamate N-carboxyanhydride. Offered by: Biosynth. Available pack sizes: 5g, 1g, 10g, 25g.

Structural formula: {0} (CAS {1})

Ethyl 3-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]propanoate (CAS 19363-27-0) is a chemical compound with the molecular formula C8H11NO5 and a molecular weight of 201.18 g/mol. IUPAC name: ethyl 3-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]propanoate. InChIKey: FHBKACWGGGMHSG-YFKPBYRVSA-N.

Identity
Molecular formulaC8H11NO5
Molecular weight201.18 g/mol
IUPAC nameethyl 3-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]propanoate
InChIKeyFHBKACWGGGMHSG-YFKPBYRVSA-N
SMILESCCOC(=O)CC[C@H]1C(=O)OC(=O)N1

Computed by PubChem (NCBI)