Products 259134-85-5
CAS 259134-85-5 is the registry number for Ro-65-3479. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1S,2R,3R,5R,6S)-2-amino-3-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid (CAS 259134-85-5) is a chemical compound with the molecular formula C8H11NO5 and a molecular weight of 201.18 g/mol. IUPAC name: (1S,2R,3R,5R,6S)-2-amino-3-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid. InChIKey: NTPXNEQCDPWJQA-AZDHXYLBSA-N.
| Molecular formula | C8H11NO5 |
|---|---|
| Molecular weight | 201.18 g/mol |
| IUPAC name | (1S,2R,3R,5R,6S)-2-amino-3-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
| InChIKey | NTPXNEQCDPWJQA-AZDHXYLBSA-N |
| SMILES | C1[C@H]2[C@@H]([C@H]2[C@@]([C@@H]1O)(C(=O)O)N)C(=O)O |
Computed by PubChem (NCBI)