CAS 1587660-78-3 is the registry number for 2-((2,5-Dioxopyrrolidin-1-yl)oxy)-2-methylpropanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(2,5-dioxopyrrolidin-1-yl)oxy-2-methylpropanoic acid (CAS 1587660-78-3) is a chemical compound with the molecular formula C8H11NO5 and a molecular weight of 201.18 g/mol. IUPAC name: 2-(2,5-dioxopyrrolidin-1-yl)oxy-2-methylpropanoic acid. InChIKey: DHXJNWNKFUOFOR-UHFFFAOYSA-N.
| Molecular formula | C8H11NO5 |
|---|---|
| Molecular weight | 201.18 g/mol |
| IUPAC name | 2-(2,5-dioxopyrrolidin-1-yl)oxy-2-methylpropanoic acid |
| InChIKey | DHXJNWNKFUOFOR-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)