Products 1561139-27-2
CAS 1561139-27-2 is the registry number for Ethyl 1-hydroxy-8-methoxy-2-oxo-1,2-dihydroquinoline-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Ethyl 1-hydroxy-8-methoxy-2-oxoquinoline-3-carboxylate (CAS 1561139-27-2) is a chemical compound with the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. IUPAC name: ethyl 1-hydroxy-8-methoxy-2-oxoquinoline-3-carboxylate. InChIKey: HMCIUTWXBHYQLI-UHFFFAOYSA-N.
| Molecular formula | C13H13NO5 |
|---|---|
| Molecular weight | 263.25 g/mol |
| IUPAC name | ethyl 1-hydroxy-8-methoxy-2-oxoquinoline-3-carboxylate |
| InChIKey | HMCIUTWXBHYQLI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C(=CC=C2)OC)N(C1=O)O |
Computed by PubChem (NCBI)