CAS 142977-63-7 is the registry number for 2,2-Difluoro-4-phenylbutanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,2-difluoro-4-phenylbutanoic acid (CAS 142977-63-7) is a chemical compound with the molecular formula C10H10F2O2 and a molecular weight of 200.18 g/mol. IUPAC name: 2,2-difluoro-4-phenylbutanoic acid. InChIKey: RNXIVWTWKFJRGM-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O2 |
|---|---|
| Molecular weight | 200.18 g/mol |
| IUPAC name | 2,2-difluoro-4-phenylbutanoic acid |
| InChIKey | RNXIVWTWKFJRGM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC(C(=O)O)(F)F |
Computed by PubChem (NCBI)