Products 142977-63-7

CAS 142977-63-7 is the registry number for 2,2-Difluoro-4-phenylbutanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2,2-difluoro-4-phenylbutanoic acid (CAS 142977-63-7) is a chemical compound with the molecular formula C10H10F2O2 and a molecular weight of 200.18 g/mol. IUPAC name: 2,2-difluoro-4-phenylbutanoic acid. InChIKey: RNXIVWTWKFJRGM-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10F2O2
Molecular weight200.18 g/mol
IUPAC name2,2-difluoro-4-phenylbutanoic acid
InChIKeyRNXIVWTWKFJRGM-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CCC(C(=O)O)(F)F

Computed by PubChem (NCBI)