CAS 14311-35-4 appears in our catalog under these names: 5-Bromo-1-Naphthaleneacetic Acid Methyl Ester, Methyl 2-(5-bromonaphthalen-1-yl)acetate, 97%, Methyl 2-(5-bromonaphthalen-1-yl)acetate. Offered by: TRC, AmBeed, Biosynth. Available pack sizes: 2,5g, 1g, 0,5g, 50mg.
Methyl 2-(5-bromonaphthalen-1-yl)acetate (CAS 14311-35-4) is a chemical compound with the molecular formula C13H11BrO2 and a molecular weight of 279.13 g/mol. IUPAC name: methyl 2-(5-bromonaphthalen-1-yl)acetate. InChIKey: LQSUXOMSRWNKMC-UHFFFAOYSA-N.
| Molecular formula | C13H11BrO2 |
|---|---|
| Molecular weight | 279.13 g/mol |
| IUPAC name | methyl 2-(5-bromonaphthalen-1-yl)acetate |
| InChIKey | LQSUXOMSRWNKMC-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=C2C=CC=C(C2=CC=C1)Br |
Computed by PubChem (NCBI)