CAS 1431616-41-9 appears in our catalog under these names: (4-(1-(Trifluoromethyl)cyclopropyl)phenyl)boronic acid, 95%, 95%, (4-(1-(TRIFLUOROMETHYL)CYCLOPROPYL)PHENYL)BORONIC ACID, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg.
[4-[1-(trifluoromethyl)cyclopropyl]phenyl]boronic acid (CAS 1431616-41-9) is a chemical compound with the molecular formula C10H10BF3O2 and a molecular weight of 229.99 g/mol. IUPAC name: [4-[1-(trifluoromethyl)cyclopropyl]phenyl]boronic acid. InChIKey: YILYOGIQBGTATO-UHFFFAOYSA-N.
| Molecular formula | C10H10BF3O2 |
|---|---|
| Molecular weight | 229.99 g/mol |
| IUPAC name | [4-[1-(trifluoromethyl)cyclopropyl]phenyl]boronic acid |
| InChIKey | YILYOGIQBGTATO-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2(CC2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)