CAS 2225171-63-9 is the registry number for (2–cyclopropyl–5–(trifluoromethyl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 10mg, 25mg.
[2-cyclopropyl-5-(trifluoromethyl)phenyl]boronic acid (CAS 2225171-63-9) is a chemical compound with the molecular formula C10H10BF3O2 and a molecular weight of 229.99 g/mol. IUPAC name: [2-cyclopropyl-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: FWRPTDQEHHJAPJ-UHFFFAOYSA-N.
| Molecular formula | C10H10BF3O2 |
|---|---|
| Molecular weight | 229.99 g/mol |
| IUPAC name | [2-cyclopropyl-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | FWRPTDQEHHJAPJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(F)(F)F)C2CC2)(O)O |
Computed by PubChem (NCBI)